C18H14F3N3O5 — CID 1142415
[(5R)-5-hydroxy-5-(4-nitrophenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 1142415) has the molecular formula C18H14F3N3O5 and a molecular weight of 409.32 g/mol. Its IUPAC name is [(5R)-5-hydroxy-5-(4-nitrophenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [(5R)-5-hydroxy-5-(4-nitrophenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 1142415 |
| Molecular Formula | C18H14F3N3O5 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [(5R)-5-hydroxy-5-(4-nitrophenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2N=C(C(F)(F)F)C[C@@]2(O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H14F3N3O5/c1-29-14-8-2-11(3-9-14)16(25)23-17(26,10-15(22-23)18(19,20)21)12-4-6-13(7-5-12)24(27)28/h2-9,26H,10H2,1H3/t17-/m1/s1 |
| InChIKey | FTOSQTZFSXYRBO-QGZVFWFLSA-N |
| XLogP | 3.21 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|