C17H12BrF3N2O2 — CID 1095423
[(5S)-5-(4-bromophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-phenylmethanone (PubChem CID 1095423) has the molecular formula C17H12BrF3N2O2 and a molecular weight of 413.19 g/mol. Its IUPAC name is [(5S)-5-(4-bromophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-phenylmethanone.
| Compound Name | [(5S)-5-(4-bromophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 1095423 |
| Molecular Formula | C17H12BrF3N2O2 |
| Molecular Weight | 413.19 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | [(5S)-5-(4-bromophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1N=C(C(F)(F)F)C[C@]1(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrF3N2O2/c18-13-8-6-12(7-9-13)16(25)10-14(17(19,20)21)22-23(16)15(24)11-4-2-1-3-5-11/h1-9,25H,10H2/t16-/m0/s1 |
| InChIKey | IILVSFAAPPNNJV-INIZCTEOSA-N |
| XLogP | 4.06 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |