C17H13BrF3N3O2 — CID 1041170
(4-aminophenyl)-[(5S)-5-(4-bromophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]methanone (PubChem CID 1041170) has the molecular formula C17H13BrF3N3O2 and a molecular weight of 428.21 g/mol. Its IUPAC name is (4-aminophenyl)-[(5S)-5-(4-bromophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[(5S)-5-(4-bromophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 1041170 |
| Molecular Formula | C17H13BrF3N3O2 |
| Molecular Weight | 428.21 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | (4-aminophenyl)-[(5S)-5-(4-bromophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2N=C(C(F)(F)F)C[C@]2(O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H13BrF3N3O2/c18-12-5-3-11(4-6-12)16(26)9-14(17(19,20)21)23-24(16)15(25)10-1-7-13(22)8-2-10/h1-8,26H,9,22H2/t16-/m0/s1 |
| InChIKey | PQGLETPGCQDPFC-INIZCTEOSA-N |
| XLogP | 3.64 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|