C18H18N2O3 — CID 11836338
[5-hydroxy-5-(4-methoxyphenyl)-3-methyl-4H-pyrazol-1-yl]-phenylmethanone (PubChem CID 11836338) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is [5-hydroxy-5-(4-methoxyphenyl)-3-methyl-4H-pyrazol-1-yl]-phenylmethanone.
| Compound Name | [5-hydroxy-5-(4-methoxyphenyl)-3-methyl-4H-pyrazol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11836338 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [5-hydroxy-5-(4-methoxyphenyl)-3-methyl-4H-pyrazol-1-yl]-phenylmethanone |
| SMILES | COc1ccc(C2(O)CC(C)=NN2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-13-12-18(22,15-8-10-16(23-2)11-9-15)20(19-13)17(21)14-6-4-3-5-7-14/h3-11,22H,12H2,1-2H3 |
| InChIKey | FSTGCQCLBJRZKR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |