C13H16N2O3 — CID 101042440
1-[5-hydroxy-5-(4-methoxyphenyl)-3-methyl-4H-pyrazol-1-yl]ethanone (PubChem CID 101042440) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-[5-hydroxy-5-(4-methoxyphenyl)-3-methyl-4H-pyrazol-1-yl]ethanone.
| Compound Name | 1-[5-hydroxy-5-(4-methoxyphenyl)-3-methyl-4H-pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 101042440 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[5-hydroxy-5-(4-methoxyphenyl)-3-methyl-4H-pyrazol-1-yl]ethanone |
| SMILES | COc1ccc(C2(O)CC(C)=NN2C(C)=O)cc1 |
| InChI | InChI=1S/C13H16N2O3/c1-9-8-13(17,15(14-9)10(2)16)11-4-6-12(18-3)7-5-11/h4-7,17H,8H2,1-3H3 |
| InChIKey | ZJBQIJOCVYYMHL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |