C20H19ClN2O5 — CID 15944881
ethyl 5-(4-chlorophenyl)-5-hydroxy-1-(4-methoxybenzoyl)-4H-pyrazole-3-carboxylate (PubChem CID 15944881) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-5-hydroxy-1-(4-methoxybenzoyl)-4H-pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-5-hydroxy-1-(4-methoxybenzoyl)-4H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 15944881 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-5-hydroxy-1-(4-methoxybenzoyl)-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(C(=O)c2ccc(OC)cc2)C(O)(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H19ClN2O5/c1-3-28-19(25)17-12-20(26,14-6-8-15(21)9-7-14)23(22-17)18(24)13-4-10-16(27-2)11-5-13/h4-11,26H,3,12H2,1-2H3 |
| InChIKey | LLMAMOTWMKOFSW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |