C16H11F3N4O4 — CID 571576
[5-hydroxy-5-(4-nitrophenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-3-ylmethanone (PubChem CID 571576) has the molecular formula C16H11F3N4O4 and a molecular weight of 380.28 g/mol. Its IUPAC name is [5-hydroxy-5-(4-nitrophenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [5-hydroxy-5-(4-nitrophenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 571576 |
| Molecular Formula | C16H11F3N4O4 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [5-hydroxy-5-(4-nitrophenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1N=C(C(F)(F)F)CC1(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H11F3N4O4/c17-16(18,19)13-8-15(25,11-3-5-12(6-4-11)23(26)27)22(21-13)14(24)10-2-1-7-20-9-10/h1-7,9,25H,8H2 |
| InChIKey | SVBWIDDKKFSXDJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|