C15H16F3N3O4 — CID 29057431
[(5S)-3-[(2R)-butan-2-yl]-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-nitrophenyl)methanone (PubChem CID 29057431) has the molecular formula C15H16F3N3O4 and a molecular weight of 359.30 g/mol. Its IUPAC name is [(5S)-3-[(2R)-butan-2-yl]-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(5S)-3-[(2R)-butan-2-yl]-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 29057431 |
| Molecular Formula | C15H16F3N3O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [(5S)-3-[(2R)-butan-2-yl]-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-nitrophenyl)methanone |
| SMILES | CC[C@@H](C)C1=NN(C(=O)c2ccc([N+](=O)[O-])cc2)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H16F3N3O4/c1-3-9(2)12-8-14(23,15(16,17)18)20(19-12)13(22)10-4-6-11(7-5-10)21(24)25/h4-7,9,23H,3,8H2,1-2H3/t9-,14+/m1/s1 |
| InChIKey | AWMFQGHMWFDQJX-OTYXRUKQSA-N |
| XLogP | 3.09 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|