C15H16F3N3O4 — CID 4085964
[3-butylidene-5-hydroxy-5-(trifluoromethyl)pyrazolidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 4085964) has the molecular formula C15H16F3N3O4 and a molecular weight of 359.30 g/mol. Its IUPAC name is [3-butylidene-5-hydroxy-5-(trifluoromethyl)pyrazolidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [3-butylidene-5-hydroxy-5-(trifluoromethyl)pyrazolidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 4085964 |
| Molecular Formula | C15H16F3N3O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [3-butylidene-5-hydroxy-5-(trifluoromethyl)pyrazolidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | CCCC=C1CC(O)(C(F)(F)F)N(C(=O)c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C15H16F3N3O4/c1-2-3-4-11-9-14(23,15(16,17)18)20(19-11)13(22)10-5-7-12(8-6-10)21(24)25/h4-8,19,23H,2-3,9H2,1H3 |
| InChIKey | WHCVVUYTHJVEQD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|