C16H18F3N3O4 — CID 1159448
1-[(5S)-5-hydroxy-3-(2-methylpropyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-(4-nitrophenyl)ethanone (PubChem CID 1159448) has the molecular formula C16H18F3N3O4 and a molecular weight of 373.33 g/mol. Its IUPAC name is 1-[(5S)-5-hydroxy-3-(2-methylpropyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-[(5S)-5-hydroxy-3-(2-methylpropyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 1159448 |
| Molecular Formula | C16H18F3N3O4 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[(5S)-5-hydroxy-3-(2-methylpropyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-(4-nitrophenyl)ethanone |
| SMILES | CC(C)CC1=NN(C(=O)Cc2ccc([N+](=O)[O-])cc2)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H18F3N3O4/c1-10(2)7-12-9-15(24,16(17,18)19)21(20-12)14(23)8-11-3-5-13(6-4-11)22(25)26/h3-6,10,24H,7-9H2,1-2H3/t15-/m0/s1 |
| InChIKey | ICMLROSKXLTSQL-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|