C13H11F4N3O4 — CID 5155659
1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-2-(4-nitrophenyl)ethanone (PubChem CID 5155659) has the molecular formula C13H11F4N3O4 and a molecular weight of 349.24 g/mol. Its IUPAC name is 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 5155659 |
| Molecular Formula | C13H11F4N3O4 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-2-(4-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N1N=C(C(F)F)CC1(O)C(F)F |
| InChI | InChI=1S/C13H11F4N3O4/c14-11(15)9-6-13(22,12(16)17)19(18-9)10(21)5-7-1-3-8(4-2-7)20(23)24/h1-4,11-12,22H,5-6H2 |
| InChIKey | OQOPZEAKKYUGKK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|