C16H12ClF4N5O5 — CID 29095016
[(5R)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazol-3-yl]methanone (PubChem CID 29095016) has the molecular formula C16H12ClF4N5O5 and a molecular weight of 465.75 g/mol. Its IUPAC name is [(5R)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazol-3-yl]methanone.
| Compound Name | [(5R)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 29095016 |
| Molecular Formula | C16H12ClF4N5O5 |
| Molecular Weight | 465.75 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | [(5R)-3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazol-3-yl]methanone |
| SMILES | O=C(c1ccn(COc2ccc([N+](=O)[O-])cc2Cl)n1)N1N=C(C(F)F)C[C@@]1(O)C(F)F |
| InChI | InChI=1S/C16H12ClF4N5O5/c17-9-5-8(26(29)30)1-2-12(9)31-7-24-4-3-10(22-24)14(27)25-16(28,15(20)21)6-11(23-25)13(18)19/h1-5,13,15,28H,6-7H2/t16-/m1/s1 |
| InChIKey | SQRFOMGZPVSCNP-MRXNPFEDSA-N |
| XLogP | 2.90 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|