C20H16ClN5O4S — CID 19276739
1-[(2-chloro-4-nitrophenoxy)methyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyrazole-3-carboxamide (PubChem CID 19276739) has the molecular formula C20H16ClN5O4S and a molecular weight of 457.90 g/mol. Its IUPAC name is 1-[(2-chloro-4-nitrophenoxy)methyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19276739 |
| Molecular Formula | C20H16ClN5O4S |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyrazole-3-carboxamide |
| SMILES | N#Cc1c(NC(=O)c2ccn(COc3ccc([N+](=O)[O-])cc3Cl)n2)sc2c1CCCC2 |
| InChI | InChI=1S/C20H16ClN5O4S/c21-15-9-12(26(28)29)5-6-17(15)30-11-25-8-7-16(24-25)19(27)23-20-14(10-22)13-3-1-2-4-18(13)31-20/h5-9H,1-4,11H2,(H,23,27) |
| InChIKey | FNRZVUSCSPRHJS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|