C16H14N8O3S — CID 19265723
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19265723) has the molecular formula C16H14N8O3S and a molecular weight of 398.41 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265723 |
| Molecular Formula | C16H14N8O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | N#Cc1c(NC(=O)c2ccn(Cn3cnc([N+](=O)[O-])n3)n2)sc2c1CCCC2 |
| InChI | InChI=1S/C16H14N8O3S/c17-7-11-10-3-1-2-4-13(10)28-15(11)19-14(25)12-5-6-22(20-12)9-23-8-18-16(21-23)24(26)27/h5-6,8H,1-4,9H2,(H,19,25) |
| InChIKey | FOTOGDSKACUVGM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|