C20H18N6O3S — CID 60617432
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]acetamide (PubChem CID 60617432) has the molecular formula C20H18N6O3S and a molecular weight of 422.47 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]acetamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 60617432 |
| Molecular Formula | C20H18N6O3S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]acetamide |
| SMILES | N#Cc1c(NC(=O)Cn2cnc(-c3ccc([N+](=O)[O-])cc3)n2)sc2c1CCCCC2 |
| InChI | InChI=1S/C20H18N6O3S/c21-10-16-15-4-2-1-3-5-17(15)30-20(16)23-18(27)11-25-12-22-19(24-25)13-6-8-14(9-7-13)26(28)29/h6-9,12H,1-5,11H2,(H,23,27) |
| InChIKey | VCRDRPDEVSLWDF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|