C24H22ClN5O4S2 — CID 22196798
2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 22196798) has the molecular formula C24H22ClN5O4S2 and a molecular weight of 544.06 g/mol. Its IUPAC name is 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 22196798 |
| Molecular Formula | C24H22ClN5O4S2 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)CN2CCN(C(=O)c3sc4cc([N+](=O)[O-])ccc4c3Cl)CC2)sc2c1CCCC2 |
| InChI | InChI=1S/C24H22ClN5O4S2/c25-21-16-6-5-14(30(33)34)11-19(16)35-22(21)24(32)29-9-7-28(8-10-29)13-20(31)27-23-17(12-26)15-3-1-2-4-18(15)36-23/h5-6,11H,1-4,7-10,13H2,(H,27,31) |
| InChIKey | UTOVXPULXXEWLX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|