C24H18Cl3N5O4S2 — CID 22196786
2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 22196786) has the molecular formula C24H18Cl3N5O4S2 and a molecular weight of 610.93 g/mol. Its IUPAC name is 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 22196786 |
| Molecular Formula | C24H18Cl3N5O4S2 |
| Molecular Weight | 610.93 g/mol |
| Exact Mass | 608.99 |
| IUPAC Name | 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)CC1)Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C24H18Cl3N5O4S2/c25-13-1-3-15(17(26)9-13)18-12-37-24(28-18)29-20(33)11-30-5-7-31(8-6-30)23(34)22-21(27)16-4-2-14(32(35)36)10-19(16)38-22/h1-4,9-10,12H,5-8,11H2,(H,28,29,33) |
| InChIKey | UGAALDCDIXLVII-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|