C21H18BrClN4O4S — CID 22196826
N-(4-bromophenyl)-2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 22196826) has the molecular formula C21H18BrClN4O4S and a molecular weight of 537.82 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22196826 |
| Molecular Formula | C21H18BrClN4O4S |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | N-(4-bromophenyl)-2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)CC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H18BrClN4O4S/c22-13-1-3-14(4-2-13)24-18(28)12-25-7-9-26(10-8-25)21(29)20-19(23)16-6-5-15(27(30)31)11-17(16)32-20/h1-6,11H,7-10,12H2,(H,24,28) |
| InChIKey | IZWPTEDMWGZWQG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|