C19H15BrClN3O5S2 — CID 22772750
[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(3-chloro-6-nitro-1-benzothiophen-2-yl)methanone (PubChem CID 22772750) has the molecular formula C19H15BrClN3O5S2 and a molecular weight of 544.84 g/mol. Its IUPAC name is [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(3-chloro-6-nitro-1-benzothiophen-2-yl)methanone.
| Compound Name | [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(3-chloro-6-nitro-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 22772750 |
| Molecular Formula | C19H15BrClN3O5S2 |
| Molecular Weight | 544.84 g/mol |
| Exact Mass | 542.93 |
| IUPAC Name | [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(3-chloro-6-nitro-1-benzothiophen-2-yl)methanone |
| SMILES | O=C(c1sc2cc([N+](=O)[O-])ccc2c1Cl)N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H15BrClN3O5S2/c20-12-1-4-14(5-2-12)31(28,29)23-9-7-22(8-10-23)19(25)18-17(21)15-6-3-13(24(26)27)11-16(15)30-18/h1-6,11H,7-10H2 |
| InChIKey | AURSRFRSBUJLMW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|