C21H20ClN3O7S2 — CID 22772765
(3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 22772765) has the molecular formula C21H20ClN3O7S2 and a molecular weight of 525.99 g/mol. Its IUPAC name is (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22772765 |
| Molecular Formula | C21H20ClN3O7S2 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.04 |
| IUPAC Name | (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3sc4cc([N+](=O)[O-])ccc4c3Cl)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H20ClN3O7S2/c1-31-14-4-6-18(16(12-14)32-2)34(29,30)24-9-7-23(8-10-24)21(26)20-19(22)15-5-3-13(25(27)28)11-17(15)33-20/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | JATWMUYECBVIBT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|