C19H15Cl2N3O5S2 — CID 17374689
(3,6-dichloro-1-benzothiophen-2-yl)-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 17374689) has the molecular formula C19H15Cl2N3O5S2 and a molecular weight of 500.39 g/mol. Its IUPAC name is (3,6-dichloro-1-benzothiophen-2-yl)-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3,6-dichloro-1-benzothiophen-2-yl)-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17374689 |
| Molecular Formula | C19H15Cl2N3O5S2 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 498.98 |
| IUPAC Name | (3,6-dichloro-1-benzothiophen-2-yl)-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1sc2cc(Cl)ccc2c1Cl)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H15Cl2N3O5S2/c20-12-1-6-15-16(11-12)30-18(17(15)21)19(25)22-7-9-23(10-8-22)31(28,29)14-4-2-13(3-5-14)24(26)27/h1-6,11H,7-10H2 |
| InChIKey | XSDBFWNDAIBRGF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|