C18H15Cl2N5O4S — CID 19575872
[4-(3,6-dichloro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-(1-methyl-4-nitropyrazol-5-yl)methanone (PubChem CID 19575872) has the molecular formula C18H15Cl2N5O4S and a molecular weight of 468.32 g/mol. Its IUPAC name is [4-(3,6-dichloro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-(1-methyl-4-nitropyrazol-5-yl)methanone.
| Compound Name | [4-(3,6-dichloro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-(1-methyl-4-nitropyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 19575872 |
| Molecular Formula | C18H15Cl2N5O4S |
| Molecular Weight | 468.32 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | [4-(3,6-dichloro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-(1-methyl-4-nitropyrazol-5-yl)methanone |
| SMILES | Cn1ncc([N+](=O)[O-])c1C(=O)N1CCN(C(=O)c2sc3cc(Cl)ccc3c2Cl)CC1 |
| InChI | InChI=1S/C18H15Cl2N5O4S/c1-22-15(12(9-21-22)25(28)29)17(26)23-4-6-24(7-5-23)18(27)16-14(20)11-3-2-10(19)8-13(11)30-16/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | XYMQDADAXCYGKN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|