C21H17Cl2N5O6S — CID 22196869
2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 22196869) has the molecular formula C21H17Cl2N5O6S and a molecular weight of 538.37 g/mol. Its IUPAC name is 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 22196869 |
| Molecular Formula | C21H17Cl2N5O6S |
| Molecular Weight | 538.37 g/mol |
| Exact Mass | 537.03 |
| IUPAC Name | 2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)CC1)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H17Cl2N5O6S/c22-15-4-2-12(27(31)32)9-16(15)24-18(29)11-25-5-7-26(8-6-25)21(30)20-19(23)14-3-1-13(28(33)34)10-17(14)35-20/h1-4,9-10H,5-8,11H2,(H,24,29) |
| InChIKey | OPLIWJQNFNDHIM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|