C21H19ClN4O6S2 — CID 22196902
methyl 2-[[2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 22196902) has the molecular formula C21H19ClN4O6S2 and a molecular weight of 522.99 g/mol. Its IUPAC name is methyl 2-[[2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22196902 |
| Molecular Formula | C21H19ClN4O6S2 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | methyl 2-[[2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)CN1CCN(C(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)CC1 |
| InChI | InChI=1S/C21H19ClN4O6S2/c1-32-21(29)14-4-9-33-19(14)23-16(27)11-24-5-7-25(8-6-24)20(28)18-17(22)13-3-2-12(26(30)31)10-15(13)34-18/h2-4,9-10H,5-8,11H2,1H3,(H,23,27) |
| InChIKey | YBWYMKDBCFISNY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|