C28H25ClN4O7S2 — CID 22196820
methyl 2-[[2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 22196820) has the molecular formula C28H25ClN4O7S2 and a molecular weight of 629.12 g/mol. Its IUPAC name is methyl 2-[[2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22196820 |
| Molecular Formula | C28H25ClN4O7S2 |
| Molecular Weight | 629.12 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | methyl 2-[[2-[4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)CN1CCN(C(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)CC1 |
| InChI | InChI=1S/C28H25ClN4O7S2/c1-39-18-6-3-16(4-7-18)20-15-41-26(23(20)28(36)40-2)30-22(34)14-31-9-11-32(12-10-31)27(35)25-24(29)19-8-5-17(33(37)38)13-21(19)42-25/h3-8,13,15H,9-12,14H2,1-2H3,(H,30,34) |
| InChIKey | LOLVCQIEDSYKDB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.12 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|