C21H20ClN3O3S — CID 22196767
(3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 22196767) has the molecular formula C21H20ClN3O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22196767 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1cccc(CN2CCN(C(=O)c3sc4cc([N+](=O)[O-])ccc4c3Cl)CC2)c1 |
| InChI | InChI=1S/C21H20ClN3O3S/c1-14-3-2-4-15(11-14)13-23-7-9-24(10-8-23)21(26)20-19(22)17-6-5-16(25(27)28)12-18(17)29-20/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | ODMCCNAYSABSIG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|