C24H21ClN4O3S2 — CID 22196883
(3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl]piperazin-1-yl]methanone (PubChem CID 22196883) has the molecular formula C24H21ClN4O3S2 and a molecular weight of 513.04 g/mol. Its IUPAC name is (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22196883 |
| Molecular Formula | C24H21ClN4O3S2 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl]piperazin-1-yl]methanone |
| SMILES | Cc1cccc(-c2nc(CN3CCN(C(=O)c4sc5cc([N+](=O)[O-])ccc5c4Cl)CC3)cs2)c1 |
| InChI | InChI=1S/C24H21ClN4O3S2/c1-15-3-2-4-16(11-15)23-26-17(14-33-23)13-27-7-9-28(10-8-27)24(30)22-21(25)19-6-5-18(29(31)32)12-20(19)34-22/h2-6,11-12,14H,7-10,13H2,1H3 |
| InChIKey | CUKFTUIXWOBBBF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|