C20H17ClFN3O3S — CID 22196774
(3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 22196774) has the molecular formula C20H17ClFN3O3S and a molecular weight of 433.89 g/mol. Its IUPAC name is (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22196774 |
| Molecular Formula | C20H17ClFN3O3S |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | (3-chloro-6-nitro-1-benzothiophen-2-yl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1sc2cc([N+](=O)[O-])ccc2c1Cl)N1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H17ClFN3O3S/c21-18-16-5-4-15(25(27)28)11-17(16)29-19(18)20(26)24-8-6-23(7-9-24)12-13-2-1-3-14(22)10-13/h1-5,10-11H,6-9,12H2 |
| InChIKey | MBWOPLFFOYXMSP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|