C16H26O6Si2 — CID 10926774
(3aR,4R,5S,6R,6aS)-5,6-bis(trimethylsilyloxy)spiro[3a,5,6,6a-tetrahydro-3H-cyclopenta[b]furan-4,5'-furan]-2,2'-dione (PubChem CID 10926774) has the molecular formula C16H26O6Si2 and a molecular weight of 370.55 g/mol. Its IUPAC name is (3aR,4R,5S,6R,6aS)-5,6-bis(trimethylsilyloxy)spiro[3a,5,6,6a-tetrahydro-3H-cyclopenta[b]furan-4,5'-furan]-2,2'-dione.
| Compound Name | (3aR,4R,5S,6R,6aS)-5,6-bis(trimethylsilyloxy)spiro[3a,5,6,6a-tetrahydro-3H-cyclopenta[b]furan-4,5'-furan]-2,2'-dione |
|---|---|
| PubChem CID | 10926774 |
| Molecular Formula | C16H26O6Si2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (3aR,4R,5S,6R,6aS)-5,6-bis(trimethylsilyloxy)spiro[3a,5,6,6a-tetrahydro-3H-cyclopenta[b]furan-4,5'-furan]-2,2'-dione |
| SMILES | C[Si](C)(C)O[C@@H]1[C@H]2OC(=O)C[C@H]2[C@]2(C=CC(=O)O2)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C16H26O6Si2/c1-23(2,3)21-14-13-10(9-12(18)19-13)16(8-7-11(17)20-16)15(14)22-24(4,5)6/h7-8,10,13-15H,9H2,1-6H3/t10-,13+,14-,15+,16-/m1/s1 |
| InChIKey | BQLFVYBTBWSQGP-NFWSPEMXSA-N |
| XLogP | 2.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|