C20H13F2N5O — CID 109270508
N-(3,4-difluorophenyl)-2-(quinolin-8-ylamino)pyrimidine-5-carboxamide (PubChem CID 109270508) has the molecular formula C20H13F2N5O and a molecular weight of 377.35 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(quinolin-8-ylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(quinolin-8-ylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109270508 |
| Molecular Formula | C20H13F2N5O |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(quinolin-8-ylamino)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1cnc(Nc2cccc3cccnc23)nc1 |
| InChI | InChI=1S/C20H13F2N5O/c21-15-7-6-14(9-16(15)22)26-19(28)13-10-24-20(25-11-13)27-17-5-1-3-12-4-2-8-23-18(12)17/h1-11H,(H,26,28)(H,24,25,27) |
| InChIKey | HQXBULZWRQUZJR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |