C17H10F4N4O — CID 109270748
2-(2,6-difluoroanilino)-N-(3,4-difluorophenyl)pyrimidine-5-carboxamide (PubChem CID 109270748) has the molecular formula C17H10F4N4O and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-(2,6-difluoroanilino)-N-(3,4-difluorophenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(2,6-difluoroanilino)-N-(3,4-difluorophenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109270748 |
| Molecular Formula | C17H10F4N4O |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-(2,6-difluoroanilino)-N-(3,4-difluorophenyl)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1cnc(Nc2c(F)cccc2F)nc1 |
| InChI | InChI=1S/C17H10F4N4O/c18-11-5-4-10(6-14(11)21)24-16(26)9-7-22-17(23-8-9)25-15-12(19)2-1-3-13(15)20/h1-8H,(H,24,26)(H,22,23,25) |
| InChIKey | WKTBMTUHKAAZTP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |