C17H20N4O3 — CID 109271821
5-(cyclopropylamino)-N-[2-(4-methoxyphenoxy)ethyl]pyrazine-2-carboxamide (PubChem CID 109271821) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-(cyclopropylamino)-N-[2-(4-methoxyphenoxy)ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-(cyclopropylamino)-N-[2-(4-methoxyphenoxy)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109271821 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-(cyclopropylamino)-N-[2-(4-methoxyphenoxy)ethyl]pyrazine-2-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cnc(NC3CC3)cn2)cc1 |
| InChI | InChI=1S/C17H20N4O3/c1-23-13-4-6-14(7-5-13)24-9-8-18-17(22)15-10-20-16(11-19-15)21-12-2-3-12/h4-7,10-12H,2-3,8-9H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | KEQJKVFWPNGLOM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|