C20H19FN4O3 — CID 109287152
5-(2-fluoroanilino)-N-[2-(4-methoxyphenoxy)ethyl]pyrazine-2-carboxamide (PubChem CID 109287152) has the molecular formula C20H19FN4O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is 5-(2-fluoroanilino)-N-[2-(4-methoxyphenoxy)ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-(2-fluoroanilino)-N-[2-(4-methoxyphenoxy)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109287152 |
| Molecular Formula | C20H19FN4O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 5-(2-fluoroanilino)-N-[2-(4-methoxyphenoxy)ethyl]pyrazine-2-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cnc(Nc3ccccc3F)cn2)cc1 |
| InChI | InChI=1S/C20H19FN4O3/c1-27-14-6-8-15(9-7-14)28-11-10-22-20(26)18-12-24-19(13-23-18)25-17-5-3-2-4-16(17)21/h2-9,12-13H,10-11H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | KZVWQBJQILZWSH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|