C14H22N4O4S — CID 109275699
5-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-(2-methoxyethyl)pyrazine-2-carboxamide (PubChem CID 109275699) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-(2-methoxyethyl)pyrazine-2-carboxamide.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-(2-methoxyethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109275699 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-(2-methoxyethyl)pyrazine-2-carboxamide |
| SMILES | CCN(c1cnc(C(=O)NCCOC)cn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H22N4O4S/c1-3-18(11-4-7-23(20,21)10-11)13-9-16-12(8-17-13)14(19)15-5-6-22-2/h8-9,11H,3-7,10H2,1-2H3,(H,15,19) |
| InChIKey | LRVSFZRYBOIYCH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|