C18H17N5O2 — CID 109276540
morpholin-4-yl-[5-(quinolin-8-ylamino)pyrazin-2-yl]methanone (PubChem CID 109276540) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is morpholin-4-yl-[5-(quinolin-8-ylamino)pyrazin-2-yl]methanone.
| Compound Name | morpholin-4-yl-[5-(quinolin-8-ylamino)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 109276540 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | morpholin-4-yl-[5-(quinolin-8-ylamino)pyrazin-2-yl]methanone |
| SMILES | O=C(c1cnc(Nc2cccc3cccnc23)cn1)N1CCOCC1 |
| InChI | InChI=1S/C18H17N5O2/c24-18(23-7-9-25-10-8-23)15-11-21-16(12-20-15)22-14-5-1-3-13-4-2-6-19-17(13)14/h1-6,11-12H,7-10H2,(H,21,22) |
| InChIKey | MNCBZYLLBCLNHX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |