C17H28N6O3 — CID 109277458
N-(2-morpholin-4-ylethyl)-5-(2-morpholin-4-ylethylamino)pyrazine-2-carboxamide (PubChem CID 109277458) has the molecular formula C17H28N6O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-5-(2-morpholin-4-ylethylamino)pyrazine-2-carboxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-5-(2-morpholin-4-ylethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109277458 |
| Molecular Formula | C17H28N6O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-5-(2-morpholin-4-ylethylamino)pyrazine-2-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1cnc(NCCN2CCOCC2)cn1 |
| InChI | InChI=1S/C17H28N6O3/c24-17(19-2-4-23-7-11-26-12-8-23)15-13-21-16(14-20-15)18-1-3-22-5-9-25-10-6-22/h13-14H,1-12H2,(H,18,21)(H,19,24) |
| InChIKey | OGSCUNGSEALXPN-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |