C17H28N6O2 — CID 109277598
(4-ethylpiperazin-1-yl)-[5-(2-morpholin-4-ylethylamino)pyrazin-2-yl]methanone (PubChem CID 109277598) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[5-(2-morpholin-4-ylethylamino)pyrazin-2-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[5-(2-morpholin-4-ylethylamino)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 109277598 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[5-(2-morpholin-4-ylethylamino)pyrazin-2-yl]methanone |
| SMILES | CCN1CCN(C(=O)c2cnc(NCCN3CCOCC3)cn2)CC1 |
| InChI | InChI=1S/C17H28N6O2/c1-2-21-5-7-23(8-6-21)17(24)15-13-20-16(14-19-15)18-3-4-22-9-11-25-12-10-22/h13-14H,2-12H2,1H3,(H,18,20) |
| InChIKey | ZGHJSWKBCRENQE-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |