C18H18N4O2 — CID 109279368
5-(2,4-dimethylanilino)-N-(furan-2-ylmethyl)pyrazine-2-carboxamide (PubChem CID 109279368) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 5-(2,4-dimethylanilino)-N-(furan-2-ylmethyl)pyrazine-2-carboxamide.
| Compound Name | 5-(2,4-dimethylanilino)-N-(furan-2-ylmethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109279368 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 5-(2,4-dimethylanilino)-N-(furan-2-ylmethyl)pyrazine-2-carboxamide |
| SMILES | Cc1ccc(Nc2cnc(C(=O)NCc3ccco3)cn2)c(C)c1 |
| InChI | InChI=1S/C18H18N4O2/c1-12-5-6-15(13(2)8-12)22-17-11-19-16(10-20-17)18(23)21-9-14-4-3-7-24-14/h3-8,10-11H,9H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | GIXKZNXICRZNKC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |