C19H20N4O5 — CID 109279444
N-(furan-2-ylmethyl)-5-(3,4,5-trimethoxyanilino)pyrazine-2-carboxamide (PubChem CID 109279444) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-(3,4,5-trimethoxyanilino)pyrazine-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-5-(3,4,5-trimethoxyanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109279444 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-(3,4,5-trimethoxyanilino)pyrazine-2-carboxamide |
| SMILES | COc1cc(Nc2cnc(C(=O)NCc3ccco3)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N4O5/c1-25-15-7-12(8-16(26-2)18(15)27-3)23-17-11-20-14(10-21-17)19(24)22-9-13-5-4-6-28-13/h4-8,10-11H,9H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | ZMSBNQPXLVXBMQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |