C19H36O4S2Si — CID 10927946
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-3-(1,3-dithian-2-yl)-1-hydroxy-3-methylbutyl]oxolan-2-one (PubChem CID 10927946) has the molecular formula C19H36O4S2Si and a molecular weight of 420.71 g/mol. Its IUPAC name is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-3-(1,3-dithian-2-yl)-1-hydroxy-3-methylbutyl]oxolan-2-one.
| Compound Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-3-(1,3-dithian-2-yl)-1-hydroxy-3-methylbutyl]oxolan-2-one |
|---|---|
| PubChem CID | 10927946 |
| Molecular Formula | C19H36O4S2Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-3-(1,3-dithian-2-yl)-1-hydroxy-3-methylbutyl]oxolan-2-one |
| SMILES | CC(C)(C[C@H](O)[C@@H]1C(=O)OC[C@H]1O[Si](C)(C)C(C)(C)C)C1SCCCS1 |
| InChI | InChI=1S/C19H36O4S2Si/c1-18(2,3)26(6,7)23-14-12-22-16(21)15(14)13(20)11-19(4,5)17-24-9-8-10-25-17/h13-15,17,20H,8-12H2,1-7H3/t13-,14+,15-/m0/s1 |
| InChIKey | HOQKKKCONHWMMI-ZNMIVQPWSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|