C24H48O4S2Si — CID 134878529
methyl (2R,3S,4S,6S)-6-[2-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-1,3-dithiolan-2-yl]-3-hydroxy-2,4-dimethylheptanoate (PubChem CID 134878529) has the molecular formula C24H48O4S2Si and a molecular weight of 492.86 g/mol. Its IUPAC name is methyl (2R,3S,4S,6S)-6-[2-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-1,3-dithiolan-2-yl]-3-hydroxy-2,4-dimethylheptanoate.
| Compound Name | methyl (2R,3S,4S,6S)-6-[2-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-1,3-dithiolan-2-yl]-3-hydroxy-2,4-dimethylheptanoate |
|---|---|
| PubChem CID | 134878529 |
| Molecular Formula | C24H48O4S2Si |
| Molecular Weight | 492.86 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | methyl (2R,3S,4S,6S)-6-[2-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-1,3-dithiolan-2-yl]-3-hydroxy-2,4-dimethylheptanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O)[C@@H](C)C[C@H](C)C1(CC[C@H](C)CO[Si](C)(C)C(C)(C)C)SCCS1 |
| InChI | InChI=1S/C24H48O4S2Si/c1-17(16-28-31(9,10)23(5,6)7)11-12-24(29-13-14-30-24)19(3)15-18(2)21(25)20(4)22(26)27-8/h17-21,25H,11-16H2,1-10H3/t17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | DXHZBALEZXAMLG-FCMAGTKHSA-N |
| XLogP | 6.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.86 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|