C20H38O5S2 — CID 23253356
methyl (2R,3S,4S)-6-[2-[(3R,4S)-3,4-dihydroxy-3-methylhexyl]-1,3-dithiolan-2-yl]-3-hydroxy-2,4-dimethylheptanoate (PubChem CID 23253356) has the molecular formula C20H38O5S2 and a molecular weight of 422.65 g/mol. Its IUPAC name is methyl (2R,3S,4S)-6-[2-[(3R,4S)-3,4-dihydroxy-3-methylhexyl]-1,3-dithiolan-2-yl]-3-hydroxy-2,4-dimethylheptanoate.
| Compound Name | methyl (2R,3S,4S)-6-[2-[(3R,4S)-3,4-dihydroxy-3-methylhexyl]-1,3-dithiolan-2-yl]-3-hydroxy-2,4-dimethylheptanoate |
|---|---|
| PubChem CID | 23253356 |
| Molecular Formula | C20H38O5S2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | methyl (2R,3S,4S)-6-[2-[(3R,4S)-3,4-dihydroxy-3-methylhexyl]-1,3-dithiolan-2-yl]-3-hydroxy-2,4-dimethylheptanoate |
| SMILES | CC[C@H](O)[C@](C)(O)CCC1(C(C)C[C@H](C)[C@H](O)[C@@H](C)C(=O)OC)SCCS1 |
| InChI | InChI=1S/C20H38O5S2/c1-7-16(21)19(5,24)8-9-20(26-10-11-27-20)14(3)12-13(2)17(22)15(4)18(23)25-6/h13-17,21-22,24H,7-12H2,1-6H3/t13-,14?,15+,16-,17-,19+/m0/s1 |
| InChIKey | LREZIMYAENCYFV-DAWDDHHESA-N |
| XLogP | 3.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |