C22H24N4O — CID 109279989
N-[(2-methylphenyl)methyl]-5-(3-phenylpropylamino)pyrazine-2-carboxamide (PubChem CID 109279989) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-5-(3-phenylpropylamino)pyrazine-2-carboxamide.
| Compound Name | N-[(2-methylphenyl)methyl]-5-(3-phenylpropylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109279989 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-5-(3-phenylpropylamino)pyrazine-2-carboxamide |
| SMILES | Cc1ccccc1CNC(=O)c1cnc(NCCCc2ccccc2)cn1 |
| InChI | InChI=1S/C22H24N4O/c1-17-8-5-6-12-19(17)14-26-22(27)20-15-25-21(16-24-20)23-13-7-11-18-9-3-2-4-10-18/h2-6,8-10,12,15-16H,7,11,13-14H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | DBTBIRVZJAWPCI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|