C22H23FN4O — CID 109284508
5-[2-(4-fluorophenyl)ethylamino]-N-(3-phenylpropyl)pyrazine-2-carboxamide (PubChem CID 109284508) has the molecular formula C22H23FN4O and a molecular weight of 378.45 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)ethylamino]-N-(3-phenylpropyl)pyrazine-2-carboxamide.
| Compound Name | 5-[2-(4-fluorophenyl)ethylamino]-N-(3-phenylpropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109284508 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 5-[2-(4-fluorophenyl)ethylamino]-N-(3-phenylpropyl)pyrazine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cnc(NCCc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C22H23FN4O/c23-19-10-8-18(9-11-19)12-14-24-21-16-26-20(15-27-21)22(28)25-13-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-11,15-16H,4,7,12-14H2,(H,24,27)(H,25,28) |
| InChIKey | VPGKQHDQBIZERO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|