C23H46O3Si2 — CID 10928064
(4S,4aR,6S,8aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-methyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one (PubChem CID 10928064) has the molecular formula C23H46O3Si2 and a molecular weight of 426.79 g/mol. Its IUPAC name is (4S,4aR,6S,8aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-methyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one.
| Compound Name | (4S,4aR,6S,8aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-methyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 10928064 |
| Molecular Formula | C23H46O3Si2 |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (4S,4aR,6S,8aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-methyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@]2(C)C(=O)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C23H46O3Si2/c1-21(2,3)27(8,9)25-17-14-15-23(7)18(16-17)19(12-13-20(23)24)26-28(10,11)22(4,5)6/h17-19H,12-16H2,1-11H3/t17-,18-,19-,23-/m0/s1 |
| InChIKey | BVUJADJSNNWPLT-KGYLXKDPSA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|