C22H44O3Si2 — CID 53242593
(4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalen-1-one (PubChem CID 53242593) has the molecular formula C22H44O3Si2 and a molecular weight of 412.76 g/mol. Its IUPAC name is (4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalen-1-one.
| Compound Name | (4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 53242593 |
| Molecular Formula | C22H44O3Si2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalen-1-one |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)C(=O)CCC[C@@]12O[Si](C)(C)C |
| InChI | InChI=1S/C22H44O3Si2/c1-19(2,3)27(10,11)24-18-14-16-21(6)17(23)13-12-15-22(21,20(18,4)5)25-26(7,8)9/h18H,12-16H2,1-11H3/t18-,21+,22+/m0/s1 |
| InChIKey | CEOOTJYADYHSIE-VLCRHTCISA-N |
| XLogP | 6.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|