C26H48O3Si2 — CID 53242847
(1R,2S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-1,5,5,8a-tetramethyl-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalene-2-carbaldehyde (PubChem CID 53242847) has the molecular formula C26H48O3Si2 and a molecular weight of 464.84 g/mol. Its IUPAC name is (1R,2S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-1,5,5,8a-tetramethyl-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalene-2-carbaldehyde.
| Compound Name | (1R,2S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-1,5,5,8a-tetramethyl-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 53242847 |
| Molecular Formula | C26H48O3Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (1R,2S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-1,5,5,8a-tetramethyl-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalene-2-carbaldehyde |
| SMILES | C#C[C@@]1(C)[C@@H](C=O)CC[C@@]2(O[Si](C)(C)C)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C26H48O3Si2/c1-14-24(7)20(19-27)15-18-26(29-30(9,10)11)23(5,6)21(16-17-25(24,26)8)28-31(12,13)22(2,3)4/h1,19-21H,15-18H2,2-13H3/t20-,21+,24+,25-,26-/m1/s1 |
| InChIKey | QKBHDEZOLTYJAR-JILMNHAFSA-N |
| XLogP | 7.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|