C19H40O3Si2 — CID 56946003
(1R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-6-trimethylsilyloxycyclohexane-1-carbaldehyde (PubChem CID 56946003) has the molecular formula C19H40O3Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is (1R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-6-trimethylsilyloxycyclohexane-1-carbaldehyde.
| Compound Name | (1R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-6-trimethylsilyloxycyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 56946003 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (1R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-6-trimethylsilyloxycyclohexane-1-carbaldehyde |
| SMILES | CC1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@](C)(O[Si](C)(C)C)[C@@H]1C=O |
| InChI | InChI=1S/C19H40O3Si2/c1-17(2,3)24(10,11)21-15-12-18(4,5)16(14-20)19(6,13-15)22-23(7,8)9/h14-16H,12-13H2,1-11H3/t15-,16-,19+/m1/s1 |
| InChIKey | USWSXFISZJDMCC-MDZRGWNJSA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|