C24H44O3Si — CID 101113595
4-[(1R,2R,4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]butan-2-one (PubChem CID 101113595) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is 4-[(1R,2R,4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]butan-2-one.
| Compound Name | 4-[(1R,2R,4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]butan-2-one |
|---|---|
| PubChem CID | 101113595 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 4-[(1R,2R,4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethylspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,2'-oxirane]-1-yl]butan-2-one |
| SMILES | CC(=O)CC[C@H]1[C@@]2(CO2)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C24H44O3Si/c1-17(25)11-12-19-23(7)14-10-13-22(5,6)20(23)18(15-24(19)16-26-24)27-28(8,9)21(2,3)4/h18-20H,10-16H2,1-9H3/t18-,19+,20-,23+,24-/m0/s1 |
| InChIKey | BAPKWMCUPODXGU-ICWLXMKVSA-N |
| XLogP | 6.37 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|