C20H20FN5O — CID 109281641
5-[4-(dimethylamino)anilino]-N-[(4-fluorophenyl)methyl]pyrazine-2-carboxamide (PubChem CID 109281641) has the molecular formula C20H20FN5O and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-[4-(dimethylamino)anilino]-N-[(4-fluorophenyl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-[4-(dimethylamino)anilino]-N-[(4-fluorophenyl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109281641 |
| Molecular Formula | C20H20FN5O |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-[4-(dimethylamino)anilino]-N-[(4-fluorophenyl)methyl]pyrazine-2-carboxamide |
| SMILES | CN(C)c1ccc(Nc2cnc(C(=O)NCc3ccc(F)cc3)cn2)cc1 |
| InChI | InChI=1S/C20H20FN5O/c1-26(2)17-9-7-16(8-10-17)25-19-13-22-18(12-23-19)20(27)24-11-14-3-5-15(21)6-4-14/h3-10,12-13H,11H2,1-2H3,(H,23,25)(H,24,27) |
| InChIKey | ITEQLBPAWIUCTF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|